C16H24O2 — CID 145488508
[4-(5-methylhexan-2-yl)cyclohexa-1,3-dien-1-yl] prop-2-enoate (PubChem CID 145488508) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is [4-(5-methylhexan-2-yl)cyclohexa-1,3-dien-1-yl] prop-2-enoate.
| Compound Name | [4-(5-methylhexan-2-yl)cyclohexa-1,3-dien-1-yl] prop-2-enoate |
|---|---|
| PubChem CID | 145488508 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [4-(5-methylhexan-2-yl)cyclohexa-1,3-dien-1-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1=CC=C(C(C)CCC(C)C)CC1 |
| InChI | InChI=1S/C16H24O2/c1-5-16(17)18-15-10-8-14(9-11-15)13(4)7-6-12(2)3/h5,8,10,12-13H,1,6-7,9,11H2,2-4H3 |
| InChIKey | RMNHESUEJKJPPV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|