C25H33N5O4 — CID 145488654
N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[propyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide (PubChem CID 145488654) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[propyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide.
| Compound Name | N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[propyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 145488654 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[propyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide |
| SMILES | CCCN(CC1C=CC(C(=O)NC2CC=CC=C2N)=NC1)C(=O)NC1C=C2OCCOC2=CC1 |
| InChI | InChI=1S/C25H33N5O4/c1-2-11-30(25(32)28-18-8-10-22-23(14-18)34-13-12-33-22)16-17-7-9-21(27-15-17)24(31)29-20-6-4-3-5-19(20)26/h3-5,7,9-10,14,17-18,20H,2,6,8,11-13,15-16,26H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | HYOZPUSGWXKABO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |