C27H37N5O4 — CID 145488691
N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[pentyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide (PubChem CID 145488691) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[pentyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide.
| Compound Name | N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[pentyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 145488691 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | N-(2-aminocyclohexa-2,4-dien-1-yl)-3-[[pentyl(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylcarbamoyl)amino]methyl]-2,3-dihydropyridine-6-carboxamide |
| SMILES | CCCCCN(CC1C=CC(C(=O)NC2CC=CC=C2N)=NC1)C(=O)NC1C=C2OCCOC2=CC1 |
| InChI | InChI=1S/C27H37N5O4/c1-2-3-6-13-32(27(34)30-20-10-12-24-25(16-20)36-15-14-35-24)18-19-9-11-23(29-17-19)26(33)31-22-8-5-4-7-21(22)28/h4-5,7,9,11-12,16,19-20,22H,2-3,6,8,10,13-15,17-18,28H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | DETAZDQGSIYJNW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|