C21H26O2P2 — CID 145489348
1',1',3,3-tetramethyl-6,6'-bis(phosphanyl)-1,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 145489348) has the molecular formula C21H26O2P2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 1',1',3,3-tetramethyl-6,6'-bis(phosphanyl)-1,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 1',1',3,3-tetramethyl-6,6'-bis(phosphanyl)-1,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 145489348 |
| Molecular Formula | C21H26O2P2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1',1',3,3-tetramethyl-6,6'-bis(phosphanyl)-1,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(O)c(P)cc32)c2cc(O)c(P)cc21 |
| InChI | InChI=1S/C21H26O2P2/c1-19(2)9-21(14-8-18(25)15(22)5-11(14)19)10-20(3,4)12-7-17(24)16(23)6-13(12)21/h5-8,22-23H,9-10,24-25H2,1-4H3 |
| InChIKey | RCBQYNZPECCXDV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|