C24H29FN2 — CID 145489428
3-benzyl-6-fluoro-1,2,3,4-tetrahydroisoquinoline;methanamine;toluene (PubChem CID 145489428) has the molecular formula C24H29FN2 and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-benzyl-6-fluoro-1,2,3,4-tetrahydroisoquinoline;methanamine;toluene.
| Compound Name | 3-benzyl-6-fluoro-1,2,3,4-tetrahydroisoquinoline;methanamine;toluene |
|---|---|
| PubChem CID | 145489428 |
| Molecular Formula | C24H29FN2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 3-benzyl-6-fluoro-1,2,3,4-tetrahydroisoquinoline;methanamine;toluene |
| SMILES | CN.Cc1ccccc1.Fc1ccc2c(c1)CC(Cc1ccccc1)NC2 |
| InChI | InChI=1S/C16H16FN.C7H8.CH5N/c17-15-7-6-13-11-18-16(10-14(13)9-15)8-12-4-2-1-3-5-12;1-7-5-3-2-4-6-7;1-2/h1-7,9,16,18H,8,10-11H2;2-6H,1H3;2H2,1H3 |
| InChIKey | UNYSHTWSDXTLFK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |