About cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide
cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 145489676) has the molecular formula C20H16CoO3P-
and a molecular weight of 394.25 g/mol. Its IUPAC name is cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide.
Molecular Properties
| Compound Name | cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
| PubChem CID | 145489676 |
| Molecular Formula | C20H16CoO3P- |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | COc1cc(P2(=O)Oc3ccccc3-c3ccccc32)[c-]cc1C.[Co] |
| InChI | InChI=1S/C20H16O3P.Co/c1-14-11-12-15(13-19(14)22-2)24(21)20-10-6-4-8-17(20)16-7-3-5-9-18(16)23-24;/h3-11,13H,1-2H3;/q-1; |
| InChIKey | HEJMZDILPJIGFY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide?
The IUPAC name of cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide (CID 145489676) is cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide.
What is the SMILES notation for cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide?
The canonical SMILES for cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide is COc1cc(P2(=O)Oc3ccccc3-c3ccccc32)[c-]cc1C.[Co].
What is the InChIKey of cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide?
The InChIKey is HEJMZDILPJIGFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O3P.Co/c1-14-11-12-15(13-19(14)22-2)24(21)20-10-6-4-8-17(20)16-7-3-5-9-18(16)23-24;/h3-11,13H,1-2H3;/q-1;.
What are the key properties of cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide?
cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide has a molecular weight of 394.25 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;6-(3-methoxy-4-methylbenzene-6-id-1-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide is sourced from PubChem (CID 145489676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).