C21H32N4O5 — CID 145490279
(2S)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 145490279) has the molecular formula C21H32N4O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2S)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145490279 |
| Molecular Formula | C21H32N4O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (2S)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | CC1([C@H](NC=O)C(=O)N2CCC[C@H]2C(=O)NCC(=O)C(=O)NC2CC2)CCCCC1 |
| InChI | InChI=1S/C21H32N4O5/c1-21(9-3-2-4-10-21)17(23-13-26)20(30)25-11-5-6-15(25)18(28)22-12-16(27)19(29)24-14-7-8-14/h13-15,17H,2-12H2,1H3,(H,22,28)(H,23,26)(H,24,29)/t15-,17+/m0/s1 |
| InChIKey | ODYGACJALSGTDO-DOTOQJQBSA-N |
| XLogP | 0.03 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|