About CID 145490755
CID 145490755 (PubChem CID 145490755) has the molecular formula C26H25F2LiN4O6S2
and a molecular weight of 598.58 g/mol.
Molecular Properties
| Compound Name | CID 145490755 |
| PubChem CID | 145490755 |
| Molecular Formula | C26H25F2LiN4O6S2 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | — |
| SMILES | CN(c1ccc2c(c1)S(=O)(=O)N=C(C1=C(O)[C@H]3[C-]([C@@H]4CC[C@H]3C4)N(Cc3ccc(F)c(F)c3)C1=O)N2)S(C)(=O)=O.[Li+] |
| InChI | InChI=1S/C26H25F2N4O6S2.Li/c1-31(39(2,35)36)16-6-8-19-20(11-16)40(37,38)30-25(29-19)22-24(33)21-14-4-5-15(10-14)23(21)32(26(22)34)12-13-3-7-17(27)18(28)9-13;/h3,6-9,11,14-15,21,33H,4-5,10,12H2,1-2H3,(H,29,30);/q-1;+1/t14-,15+,21+;/m0./s1 |
| InChIKey | VBLLNRYHONRINO-PDMMKJCGSA-N |
| XLogP | 0.31 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 145490755 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145490755?
The IUPAC name of CID 145490755 (CID 145490755) is not available.
What is the SMILES notation for CID 145490755?
The canonical SMILES for CID 145490755 is CN(c1ccc2c(c1)S(=O)(=O)N=C(C1=C(O)[C@H]3[C-]([C@@H]4CC[C@H]3C4)N(Cc3ccc(F)c(F)c3)C1=O)N2)S(C)(=O)=O.[Li+].
What is the InChIKey of CID 145490755?
The InChIKey is VBLLNRYHONRINO-PDMMKJCGSA-N. The full InChI is InChI=1S/C26H25F2N4O6S2.Li/c1-31(39(2,35)36)16-6-8-19-20(11-16)40(37,38)30-25(29-19)22-24(33)21-14-4-5-15(10-14)23(21)32(26(22)34)12-13-3-7-17(27)18(28)9-13;/h3,6-9,11,14-15,21,33H,4-5,10,12H2,1-2H3,(H,29,30);/q-1;+1/t14-,15+,21+;/m0./s1.
What are the key properties of CID 145490755?
CID 145490755 has a molecular weight of 598.58 g/mol, XLogP of 0.31, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145490755 is sourced from PubChem (CID 145490755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).