C4H5N3O4 — CID 14549084
1-(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 14549084) has the molecular formula C4H5N3O4 and a molecular weight of 159.10 g/mol. Its IUPAC name is 1-(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 14549084 |
| Molecular Formula | C4H5N3O4 |
| Molecular Weight | 159.10 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | 1-(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CO)c(=O)[nH]1 |
| InChI | InChI=1S/C4H5N3O4/c8-1-7-3(10)5-2(9)6-4(7)11/h8H,1H2,(H2,5,6,9,10,11) |
| InChIKey | YBUHIGFHWQQVQR-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.10 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |