C34H47N5O3 — CID 145491900
(3E,5E)-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-hydroxy-6-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-4-propan-2-ylhepta-3,5-dien-1-one;ethene (PubChem CID 145491900) has the molecular formula C34H47N5O3 and a molecular weight of 573.78 g/mol. Its IUPAC name is (3E,5E)-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-hydroxy-6-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-4-propan-2-ylhepta-3,5-dien-1-one;ethene.
| Compound Name | (3E,5E)-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-hydroxy-6-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-4-propan-2-ylhepta-3,5-dien-1-one;ethene |
|---|---|
| PubChem CID | 145491900 |
| Molecular Formula | C34H47N5O3 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.37 |
| IUPAC Name | (3E,5E)-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-hydroxy-6-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-4-propan-2-ylhepta-3,5-dien-1-one;ethene |
| SMILES | C=C.COc1ccccc1-c1c[nH]c2ncc(/C(C)=C/C(=C(/O)CC(=O)N3CCN(CCN(C)C)CC3)C(C)C)cc12 |
| InChI | InChI=1S/C32H43N5O3.C2H4/c1-22(2)26(29(38)19-31(39)37-15-13-36(14-16-37)12-11-35(4)5)17-23(3)24-18-27-28(21-34-32(27)33-20-24)25-9-7-8-10-30(25)40-6;1-2/h7-10,17-18,20-22,38H,11-16,19H2,1-6H3,(H,33,34);1-2H2/b23-17+,29-26-; |
| InChIKey | NKDIMPRYAAJQED-RYNKSLPMSA-N |
| XLogP | 6.01 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|