C27H33FN2 — CID 145492819
(11S,13R,17S)-4-fluoro-11,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-methylpyridine (PubChem CID 145492819) has the molecular formula C27H33FN2 and a molecular weight of 404.57 g/mol. Its IUPAC name is (11S,13R,17S)-4-fluoro-11,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-methylpyridine.
| Compound Name | (11S,13R,17S)-4-fluoro-11,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-methylpyridine |
|---|---|
| PubChem CID | 145492819 |
| Molecular Formula | C27H33FN2 |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (11S,13R,17S)-4-fluoro-11,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-methylpyridine |
| SMILES | C[C@H]1C[C@@]2(C)C(CC[C@@H]2C)C2CCc3c(ccc(C#N)c3F)C21.Cc1ccncc1 |
| InChI | InChI=1S/C21H26FN.C6H7N/c1-12-10-21(3)13(2)4-9-18(21)17-8-7-16-15(19(12)17)6-5-14(11-23)20(16)22;1-6-2-4-7-5-3-6/h5-6,12-13,17-19H,4,7-10H2,1-3H3;2-5H,1H3/t12-,13-,17?,18?,19?,21+;/m0./s1 |
| InChIKey | WPEIHHLVGNPNBQ-GHWOOIOLSA-N |
| XLogP | 6.83 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |