C52H86N4O12 — CID 14549313
tetrakis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 14549313) has the molecular formula C52H86N4O12 and a molecular weight of 959.28 g/mol. Its IUPAC name is tetrakis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 14549313 |
| Molecular Formula | C52H86N4O12 |
| Molecular Weight | 959.28 g/mol |
| Exact Mass | 958.62 |
| IUPAC Name | tetrakis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CC(=O)N1C(C)(C)CC(OC(=O)CC(C(=O)OC2CC(C)(C)N(C(C)=O)C(C)(C)C2)C(CC(=O)OC2CC(C)(C)N(C(C)=O)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C(C)=O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C52H86N4O12/c1-31(57)53-45(5,6)23-35(24-46(53,7)8)65-41(61)21-39(43(63)67-37-27-49(13,14)55(33(3)59)50(15,16)28-37)40(44(64)68-38-29-51(17,18)56(34(4)60)52(19,20)30-38)22-42(62)66-36-25-47(9,10)54(32(2)58)48(11,12)26-36/h35-40H,21-30H2,1-20H3 |
| InChIKey | IQRJSRQFYMRAIO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 186.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.28 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|