C31H25Cl2FN2O5S — CID 145493185
(3R)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)-6-(morpholine-4-carbonyl)-5-oxo-2,3-dihydroindolizine-1-sulfinic acid (PubChem CID 145493185) has the molecular formula C31H25Cl2FN2O5S and a molecular weight of 627.52 g/mol. Its IUPAC name is (3R)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)-6-(morpholine-4-carbonyl)-5-oxo-2,3-dihydroindolizine-1-sulfinic acid.
| Compound Name | (3R)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)-6-(morpholine-4-carbonyl)-5-oxo-2,3-dihydroindolizine-1-sulfinic acid |
|---|---|
| PubChem CID | 145493185 |
| Molecular Formula | C31H25Cl2FN2O5S |
| Molecular Weight | 627.52 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | (3R)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)-6-(morpholine-4-carbonyl)-5-oxo-2,3-dihydroindolizine-1-sulfinic acid |
| SMILES | O=C(c1ccc2n(c1=O)[C@@H](c1ccc(Cl)cc1)C(c1ccc(Cl)cc1)C2(c1ccccc1F)S(=O)O)N1CCOCC1 |
| InChI | InChI=1S/C31H25Cl2FN2O5S/c32-21-9-5-19(6-10-21)27-28(20-7-11-22(33)12-8-20)36-26(31(27,42(39)40)24-3-1-2-4-25(24)34)14-13-23(30(36)38)29(37)35-15-17-41-18-16-35/h1-14,27-28H,15-18H2,(H,39,40)/t27?,28-,31?/m0/s1 |
| InChIKey | OMULZGACROOANZ-AYBQCNAMSA-N |
| XLogP | 5.62 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|