C28H32F2N6O2 — CID 145493419
N-[[1-[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-4-amino-5-methyl-2,5-dihydropyrrol-3-yl]-aminomethylidene]-2,3-difluorobenzamide (PubChem CID 145493419) has the molecular formula C28H32F2N6O2 and a molecular weight of 522.60 g/mol. Its IUPAC name is N-[[1-[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-4-amino-5-methyl-2,5-dihydropyrrol-3-yl]-aminomethylidene]-2,3-difluorobenzamide.
| Compound Name | N-[[1-[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-4-amino-5-methyl-2,5-dihydropyrrol-3-yl]-aminomethylidene]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 145493419 |
| Molecular Formula | C28H32F2N6O2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[[1-[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-4-amino-5-methyl-2,5-dihydropyrrol-3-yl]-aminomethylidene]-2,3-difluorobenzamide |
| SMILES | CC1C(N)=C(/C(N)=N/C(=O)c2cccc(F)c2F)CN1C(=O)N1C[C@@H]2CCCN2C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H32F2N6O2/c1-17-25(31)22(26(32)33-27(37)21-10-5-11-23(29)24(21)30)16-35(17)28(38)36-15-19-9-6-12-34(19)14-20(36)13-18-7-3-2-4-8-18/h2-5,7-8,10-11,17,19-20H,6,9,12-16,31H2,1H3,(H2,32,33,37)/t17?,19-,20-/m0/s1 |
| InChIKey | JGQYOAQBSMRZNG-MFUMQWNRSA-N |
| XLogP | 2.89 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|