C26H39N7O2 — CID 145493427
N-[5-(6,8-dimethyl-6,9-diazaspiro[4.5]decane-9-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyridine-2-carboxamide;ethane (PubChem CID 145493427) has the molecular formula C26H39N7O2 and a molecular weight of 481.65 g/mol. Its IUPAC name is N-[5-(6,8-dimethyl-6,9-diazaspiro[4.5]decane-9-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyridine-2-carboxamide;ethane.
| Compound Name | N-[5-(6,8-dimethyl-6,9-diazaspiro[4.5]decane-9-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 145493427 |
| Molecular Formula | C26H39N7O2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | N-[5-(6,8-dimethyl-6,9-diazaspiro[4.5]decane-9-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyridine-2-carboxamide;ethane |
| SMILES | CC.CC1CN(C)C2(CCCC2)CN1C(=O)N1Cc2c(NC(=O)c3ccccn3)n[nH]c2C1(C)C |
| InChI | InChI=1S/C24H33N7O2.C2H6/c1-16-13-29(4)24(10-6-7-11-24)15-30(16)22(33)31-14-17-19(23(31,2)3)27-28-20(17)26-21(32)18-9-5-8-12-25-18;1-2/h5,8-9,12,16H,6-7,10-11,13-15H2,1-4H3,(H2,26,27,28,32);1-2H3 |
| InChIKey | QXIWKITVSQLOBZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |