C14H18BrN3O2S — CID 145493521
(2E)-3-(5-bromo-5,6-dihydro-1H-indol-3-yl)-2-hydroxyimino-N-(2-methylsulfanylethyl)propanamide (PubChem CID 145493521) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is (2E)-3-(5-bromo-5,6-dihydro-1H-indol-3-yl)-2-hydroxyimino-N-(2-methylsulfanylethyl)propanamide.
| Compound Name | (2E)-3-(5-bromo-5,6-dihydro-1H-indol-3-yl)-2-hydroxyimino-N-(2-methylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 145493521 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | (2E)-3-(5-bromo-5,6-dihydro-1H-indol-3-yl)-2-hydroxyimino-N-(2-methylsulfanylethyl)propanamide |
| SMILES | CSCCNC(=O)/C(Cc1c[nH]c2c1=CC(Br)CC=2)=N/O |
| InChI | InChI=1S/C14H18BrN3O2S/c1-21-5-4-16-14(19)13(18-20)6-9-8-17-12-3-2-10(15)7-11(9)12/h3,7-8,10,17,20H,2,4-6H2,1H3,(H,16,19)/b18-13+ |
| InChIKey | OYPUWWNPKBGOFL-QGOAFFKASA-N |
| XLogP | 0.59 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|