About 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one
3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one (PubChem CID 145493838) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one.
Molecular Properties
| Compound Name | 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one |
| PubChem CID | 145493838 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C1=C(/C=C\C)CCO1 |
| InChI | InChI=1S/C11H14O2/c1-4-5-10-6-7-13-11(10)8(2)9(3)12/h4-5H,2,6-7H2,1,3H3/b5-4- |
| InChIKey | HSNNSDYJLJXULM-PLNGDYQASA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one?
The IUPAC name of 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one (CID 145493838) is 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one.
What is the SMILES notation for 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one?
The canonical SMILES for 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one is C=C(C(C)=O)C1=C(/C=C\C)CCO1.
What is the InChIKey of 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one?
The InChIKey is HSNNSDYJLJXULM-PLNGDYQASA-N. The full InChI is InChI=1S/C11H14O2/c1-4-5-10-6-7-13-11(10)8(2)9(3)12/h4-5H,2,6-7H2,1,3H3/b5-4-.
What are the key properties of 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one?
3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one has a molecular weight of 178.23 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(Z)-prop-1-enyl]-2,3-dihydrofuran-5-yl]but-3-en-2-one is sourced from PubChem (CID 145493838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).