About ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile
ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile (PubChem CID 145493954) has the molecular formula C22H19N3O
and a molecular weight of 341.41 g/mol. Its IUPAC name is ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile |
| PubChem CID | 145493954 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile |
| SMILES | C=CO.Cc1ccc(-n2cc(C#N)c(-c3c[nH]c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C20H15N3.C2H4O/c1-14-6-8-16(9-7-14)23-12-15(10-21)19(13-23)18-11-22-20-5-3-2-4-17(18)20;1-2-3/h2-9,11-13,22H,1H3;2-3H,1H2 |
| InChIKey | BKNPLKIQXZWJRR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile?
The IUPAC name of ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile (CID 145493954) is ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile.
What is the SMILES notation for ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile?
The canonical SMILES for ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile is C=CO.Cc1ccc(-n2cc(C#N)c(-c3c[nH]c4ccccc34)c2)cc1.
What is the InChIKey of ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile?
The InChIKey is BKNPLKIQXZWJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3.C2H4O/c1-14-6-8-16(9-7-14)23-12-15(10-21)19(13-23)18-11-22-20-5-3-2-4-17(18)20;1-2-3/h2-9,11-13,22H,1H3;2-3H,1H2.
What are the key properties of ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile?
ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile has a molecular weight of 341.41 g/mol, XLogP of 5.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;4-(1H-indol-3-yl)-1-(4-methylphenyl)pyrrole-3-carbonitrile is sourced from PubChem (CID 145493954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).