C17H27NO2 — CID 145494425
(9E,12S)-4-hydroxy-7-methyl-12-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-9-en-2-one (PubChem CID 145494425) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (9E,12S)-4-hydroxy-7-methyl-12-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-9-en-2-one.
| Compound Name | (9E,12S)-4-hydroxy-7-methyl-12-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 145494425 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (9E,12S)-4-hydroxy-7-methyl-12-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-9-en-2-one |
| SMILES | C=C/C=C(\C)[C@@H]1C/C=C/CC(C)CCC(O)CC(=O)N1 |
| InChI | InChI=1S/C17H27NO2/c1-4-7-14(3)16-9-6-5-8-13(2)10-11-15(19)12-17(20)18-16/h4-7,13,15-16,19H,1,8-12H2,2-3H3,(H,18,20)/b6-5+,14-7+/t13?,15?,16-/m0/s1 |
| InChIKey | OPPKRBQTYURJKX-CJYMBVJXSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|