C19H21N7O3S — CID 145494862
2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-3H-1,2,4-triazol-4-yl]-4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 145494862) has the molecular formula C19H21N7O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-3H-1,2,4-triazol-4-yl]-4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-3H-1,2,4-triazol-4-yl]-4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 145494862 |
| Molecular Formula | C19H21N7O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-3H-1,2,4-triazol-4-yl]-4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N2C=NN(Cc3c(C)noc3C)C2O)sc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C19H21N7O3S/c1-11-15(13(3)29-24-11)9-26-19(28)25(10-22-26)18-23-12(2)16(30-18)17(27)21-8-14-5-4-6-20-7-14/h4-7,10,19,28H,8-9H2,1-3H3,(H,21,27) |
| InChIKey | NOOSYVCZQWVNGR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |