C42H62N2O2 — CID 145495086
N-[[4-(dimethylamino)phenyl]methyl]-3-[[3-hydroxy-4,10-dimethyl-4-(4-methylpentyl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl]benzamide (PubChem CID 145495086) has the molecular formula C42H62N2O2 and a molecular weight of 626.97 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-[[3-hydroxy-4,10-dimethyl-4-(4-methylpentyl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl]benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[[3-hydroxy-4,10-dimethyl-4-(4-methylpentyl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl]benzamide |
|---|---|
| PubChem CID | 145495086 |
| Molecular Formula | C42H62N2O2 |
| Molecular Weight | 626.97 g/mol |
| Exact Mass | 626.48 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[[3-hydroxy-4,10-dimethyl-4-(4-methylpentyl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl]benzamide |
| SMILES | CC(C)CCCC1(C)C(O)CCC2(C)C3CCC4(Cc5cccc(C(=O)NCc6ccc(N(C)C)cc6)c5)CCCC4C3CCC12 |
| InChI | InChI=1S/C42H62N2O2/c1-29(2)10-8-22-41(4)37-19-18-34-35(40(37,3)24-21-38(41)45)20-25-42(23-9-13-36(34)42)27-31-11-7-12-32(26-31)39(46)43-28-30-14-16-33(17-15-30)44(5)6/h7,11-12,14-17,26,29,34-38,45H,8-10,13,18-25,27-28H2,1-6H3,(H,43,46) |
| InChIKey | FRILDLUDGBKXRL-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.97 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|