C27H40N4O2 — CID 145495124
3-[2-(methylamino)ethyl]-N-[[4-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]phenyl]methyl]benzamide (PubChem CID 145495124) has the molecular formula C27H40N4O2 and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]-N-[[4-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]phenyl]methyl]benzamide.
| Compound Name | 3-[2-(methylamino)ethyl]-N-[[4-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 145495124 |
| Molecular Formula | C27H40N4O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | 3-[2-(methylamino)ethyl]-N-[[4-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]phenyl]methyl]benzamide |
| SMILES | CNCCc1cccc(C(=O)NCc2ccc(OCCCN3CCN(C(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C27H40N4O2/c1-22(2)31-17-15-30(16-18-31)14-5-19-33-26-10-8-24(9-11-26)21-29-27(32)25-7-4-6-23(20-25)12-13-28-3/h4,6-11,20,22,28H,5,12-19,21H2,1-3H3,(H,29,32) |
| InChIKey | LPIBOHLPZYRSCD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|