C32H39ClN4O4 — CID 145495541
3-chloro-N-ethyl-2,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide;2-(dimethylamino)-5-formamido-N-formyl-1,3-dihydroindene-2-carboxamide (PubChem CID 145495541) has the molecular formula C32H39ClN4O4 and a molecular weight of 579.14 g/mol. Its IUPAC name is 3-chloro-N-ethyl-2,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide;2-(dimethylamino)-5-formamido-N-formyl-1,3-dihydroindene-2-carboxamide.
| Compound Name | 3-chloro-N-ethyl-2,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide;2-(dimethylamino)-5-formamido-N-formyl-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 145495541 |
| Molecular Formula | C32H39ClN4O4 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 3-chloro-N-ethyl-2,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide;2-(dimethylamino)-5-formamido-N-formyl-1,3-dihydroindene-2-carboxamide |
| SMILES | CCN(Cc1ccc2ccccc2c1)C(=O)C(C)(C)CCl.CN(C)C1(C(=O)NC=O)Cc2ccc(NC=O)cc2C1 |
| InChI | InChI=1S/C18H22ClNO.C14H17N3O3/c1-4-20(17(21)18(2,3)13-19)12-14-9-10-15-7-5-6-8-16(15)11-14;1-17(2)14(13(20)16-9-19)6-10-3-4-12(15-8-18)5-11(10)7-14/h5-11H,4,12-13H2,1-3H3;3-5,8-9H,6-7H2,1-2H3,(H,15,18)(H,16,19,20) |
| InChIKey | GDKXIKSPAJJGNG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|