About 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane
5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane (PubChem CID 145495997) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane.
Molecular Properties
| Compound Name | 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane |
| PubChem CID | 145495997 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane |
| SMILES | CC.CC.Cc1nc(N)nc(NC2CCOC2)c1C |
| InChI | InChI=1S/C10H16N4O.2C2H6/c1-6-7(2)12-10(11)14-9(6)13-8-3-4-15-5-8;2*1-2/h8H,3-5H2,1-2H3,(H3,11,12,13,14);2*1-2H3 |
| InChIKey | NXCPAJJBQOGHAB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane?
The IUPAC name of 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane (CID 145495997) is 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane.
What is the SMILES notation for 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane?
The canonical SMILES for 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane is CC.CC.Cc1nc(N)nc(NC2CCOC2)c1C.
What is the InChIKey of 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane?
The InChIKey is NXCPAJJBQOGHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O.2C2H6/c1-6-7(2)12-10(11)14-9(6)13-8-3-4-15-5-8;2*1-2/h8H,3-5H2,1-2H3,(H3,11,12,13,14);2*1-2H3.
What are the key properties of 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane?
5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane has a molecular weight of 268.40 g/mol, XLogP of 2.93, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine;ethane is sourced from PubChem (CID 145495997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).