C24H26N6OS — CID 145496907
4-N-(2-methyl-1H-indol-5-yl)-2-N-[3-(1-sulfanylpiperidin-4-yl)oxyphenyl]pyrimidine-2,4-diamine (PubChem CID 145496907) has the molecular formula C24H26N6OS and a molecular weight of 446.58 g/mol. Its IUPAC name is 4-N-(2-methyl-1H-indol-5-yl)-2-N-[3-(1-sulfanylpiperidin-4-yl)oxyphenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-methyl-1H-indol-5-yl)-2-N-[3-(1-sulfanylpiperidin-4-yl)oxyphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145496907 |
| Molecular Formula | C24H26N6OS |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-N-(2-methyl-1H-indol-5-yl)-2-N-[3-(1-sulfanylpiperidin-4-yl)oxyphenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc2cc(Nc3ccnc(Nc4cccc(OC5CCN(S)CC5)c4)n3)ccc2[nH]1 |
| InChI | InChI=1S/C24H26N6OS/c1-16-13-17-14-19(5-6-22(17)26-16)27-23-7-10-25-24(29-23)28-18-3-2-4-21(15-18)31-20-8-11-30(32)12-9-20/h2-7,10,13-15,20,26,32H,8-9,11-12H2,1H3,(H2,25,27,28,29) |
| InChIKey | YMCWQRWFALWTKV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|