C13H15N7O — CID 145496990
2-N-(4-amino-3-methoxyphenyl)-6-N-methyl-7H-purine-2,6-diamine (PubChem CID 145496990) has the molecular formula C13H15N7O and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-N-(4-amino-3-methoxyphenyl)-6-N-methyl-7H-purine-2,6-diamine.
| Compound Name | 2-N-(4-amino-3-methoxyphenyl)-6-N-methyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 145496990 |
| Molecular Formula | C13H15N7O |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-N-(4-amino-3-methoxyphenyl)-6-N-methyl-7H-purine-2,6-diamine |
| SMILES | CNc1nc(Nc2ccc(N)c(OC)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H15N7O/c1-15-11-10-12(17-6-16-10)20-13(19-11)18-7-3-4-8(14)9(5-7)21-2/h3-6H,14H2,1-2H3,(H3,15,16,17,18,19,20) |
| InChIKey | IRTDZMSLTMFJAR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|