About 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane
5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane (PubChem CID 145497278) has the molecular formula C14H28F2N2O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane.
Molecular Properties
| Compound Name | 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane |
| PubChem CID | 145497278 |
| Molecular Formula | C14H28F2N2O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane |
| SMILES | CC.CC.O=C1COCC(CN2CCC(F)(F)CC2)N1 |
| InChI | InChI=1S/C10H16F2N2O2.2C2H6/c11-10(12)1-3-14(4-2-10)5-8-6-16-7-9(15)13-8;2*1-2/h8H,1-7H2,(H,13,15);2*1-2H3 |
| InChIKey | PXVIYBYDKUZTOD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane?
The IUPAC name of 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane (CID 145497278) is 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane.
What is the SMILES notation for 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane?
The canonical SMILES for 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane is CC.CC.O=C1COCC(CN2CCC(F)(F)CC2)N1.
What is the InChIKey of 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane?
The InChIKey is PXVIYBYDKUZTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N2O2.2C2H6/c11-10(12)1-3-14(4-2-10)5-8-6-16-7-9(15)13-8;2*1-2/h8H,1-7H2,(H,13,15);2*1-2H3.
What are the key properties of 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane?
5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane has a molecular weight of 294.39 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,4-difluoropiperidin-1-yl)methyl]morpholin-3-one;ethane is sourced from PubChem (CID 145497278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).