About 2H-1,5-naphthyridin-3-one;dihydrochloride
2H-1,5-naphthyridin-3-one;dihydrochloride (PubChem CID 145497482) has the molecular formula C8H8Cl2N2O
and a molecular weight of 219.07 g/mol. Its IUPAC name is 2H-1,5-naphthyridin-3-one;dihydrochloride.
Molecular Properties
| Compound Name | 2H-1,5-naphthyridin-3-one;dihydrochloride |
| PubChem CID | 145497482 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2H-1,5-naphthyridin-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1C=c2ncccc2=NC1 |
| InChI | InChI=1S/C8H6N2O.2ClH/c11-6-4-8-7(10-5-6)2-1-3-9-8;;/h1-4H,5H2;2*1H |
| InChIKey | GFTAXJANFWCRET-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,5-naphthyridin-3-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,5-naphthyridin-3-one;dihydrochloride?
The IUPAC name of 2H-1,5-naphthyridin-3-one;dihydrochloride (CID 145497482) is 2H-1,5-naphthyridin-3-one;dihydrochloride.
What is the SMILES notation for 2H-1,5-naphthyridin-3-one;dihydrochloride?
The canonical SMILES for 2H-1,5-naphthyridin-3-one;dihydrochloride is Cl.Cl.O=C1C=c2ncccc2=NC1.
What is the InChIKey of 2H-1,5-naphthyridin-3-one;dihydrochloride?
The InChIKey is GFTAXJANFWCRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.2ClH/c11-6-4-8-7(10-5-6)2-1-3-9-8;;/h1-4H,5H2;2*1H.
What are the key properties of 2H-1,5-naphthyridin-3-one;dihydrochloride?
2H-1,5-naphthyridin-3-one;dihydrochloride has a molecular weight of 219.07 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,5-naphthyridin-3-one;dihydrochloride is sourced from PubChem (CID 145497482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).