About [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate
[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate (PubChem CID 145497911) has the molecular formula C11H15NO8
and a molecular weight of 289.24 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate.
Molecular Properties
| Compound Name | [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate |
| PubChem CID | 145497911 |
| Molecular Formula | C11H15NO8 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate |
| SMILES | CC(=O)C(C)NC(=O)OC1=C(O)C(C(O)CO)OC1=O |
| InChI | InChI=1S/C11H15NO8/c1-4(5(2)14)12-11(18)20-9-7(16)8(6(15)3-13)19-10(9)17/h4,6,8,13,15-16H,3H2,1-2H3,(H,12,18) |
| InChIKey | SPSRTMGJSMJRGF-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate?
The IUPAC name of [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate (CID 145497911) is [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate.
What is the SMILES notation for [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate?
The canonical SMILES for [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate is CC(=O)C(C)NC(=O)OC1=C(O)C(C(O)CO)OC1=O.
What is the InChIKey of [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate?
The InChIKey is SPSRTMGJSMJRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO8/c1-4(5(2)14)12-11(18)20-9-7(16)8(6(15)3-13)19-10(9)17/h4,6,8,13,15-16H,3H2,1-2H3,(H,12,18).
What are the key properties of [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate?
[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate has a molecular weight of 289.24 g/mol, XLogP of -1.26, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] N-(3-oxobutan-2-yl)carbamate is sourced from PubChem (CID 145497911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).