C27H35F2N3 — CID 145498004
(3E,5E)-3-(1,1-difluoroethyl)-2-N-ethyl-6-N-[4-(methylaminomethyl)phenyl]-2-N-[(2-methylphenyl)methyl]hepta-1,3,5-triene-2,6-diamine (PubChem CID 145498004) has the molecular formula C27H35F2N3 and a molecular weight of 439.59 g/mol. Its IUPAC name is (3E,5E)-3-(1,1-difluoroethyl)-2-N-ethyl-6-N-[4-(methylaminomethyl)phenyl]-2-N-[(2-methylphenyl)methyl]hepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3E,5E)-3-(1,1-difluoroethyl)-2-N-ethyl-6-N-[4-(methylaminomethyl)phenyl]-2-N-[(2-methylphenyl)methyl]hepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 145498004 |
| Molecular Formula | C27H35F2N3 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | (3E,5E)-3-(1,1-difluoroethyl)-2-N-ethyl-6-N-[4-(methylaminomethyl)phenyl]-2-N-[(2-methylphenyl)methyl]hepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C(/C(=C\C=C(/C)Nc1ccc(CNC)cc1)C(C)(F)F)N(CC)Cc1ccccc1C |
| InChI | InChI=1S/C27H35F2N3/c1-7-32(19-24-11-9-8-10-20(24)2)22(4)26(27(5,28)29)17-12-21(3)31-25-15-13-23(14-16-25)18-30-6/h8-17,30-31H,4,7,18-19H2,1-3,5-6H3/b21-12+,26-17+ |
| InChIKey | LIQAEIGUXHZIGG-ZOZWWFQPSA-N |
| XLogP | 6.65 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|