About 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine
2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine (PubChem CID 145498149) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine.
Molecular Properties
| Compound Name | 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine |
| PubChem CID | 145498149 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine |
| SMILES | C=C/C=C(\C)c1ccc(C)nc1 |
| InChI | InChI=1S/C11H13N/c1-4-5-9(2)11-7-6-10(3)12-8-11/h4-8H,1H2,2-3H3/b9-5+ |
| InChIKey | ZDHDFYXIABOWET-WEVVVXLNSA-N |
| XLogP | 2.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine?
The IUPAC name of 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine (CID 145498149) is 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine.
What is the SMILES notation for 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine?
The canonical SMILES for 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine is C=C/C=C(\C)c1ccc(C)nc1.
What is the InChIKey of 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine?
The InChIKey is ZDHDFYXIABOWET-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H13N/c1-4-5-9(2)11-7-6-10(3)12-8-11/h4-8H,1H2,2-3H3/b9-5+.
What are the key properties of 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine?
2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine has a molecular weight of 159.23 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(2E)-penta-2,4-dien-2-yl]pyridine is sourced from PubChem (CID 145498149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).