About 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole
6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole (PubChem CID 145498339) has the molecular formula C21H20N2
and a molecular weight of 300.41 g/mol. Its IUPAC name is 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole.
Molecular Properties
| Compound Name | 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole |
| PubChem CID | 145498339 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole |
| SMILES | Cn1c(-c2ccccc2)nc2ccc(C3=CCCCC=C3)cc21 |
| InChI | InChI=1S/C21H20N2/c1-23-20-15-18(16-9-5-2-3-6-10-16)13-14-19(20)22-21(23)17-11-7-4-8-12-17/h4-5,7-15H,2-3,6H2,1H3 |
| InChIKey | RPLCBOOGJUXZRB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole?
The IUPAC name of 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole (CID 145498339) is 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole.
What is the SMILES notation for 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole?
The canonical SMILES for 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole is Cn1c(-c2ccccc2)nc2ccc(C3=CCCCC=C3)cc21.
What is the InChIKey of 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole?
The InChIKey is RPLCBOOGJUXZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2/c1-23-20-15-18(16-9-5-2-3-6-10-16)13-14-19(20)22-21(23)17-11-7-4-8-12-17/h4-5,7-15H,2-3,6H2,1H3.
What are the key properties of 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole?
6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole has a molecular weight of 300.41 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohepta-1,6-dien-1-yl-1-methyl-2-phenylbenzimidazole is sourced from PubChem (CID 145498339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).