About (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene
(3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene (PubChem CID 145498388) has the molecular formula C12H21FO2
and a molecular weight of 216.30 g/mol. Its IUPAC name is (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene.
Molecular Properties
| Compound Name | (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene |
| PubChem CID | 145498388 |
| Molecular Formula | C12H21FO2 |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene |
| SMILES | CC/C=C\C(OCCOC)=C(\CC)CF |
| InChI | InChI=1S/C12H21FO2/c1-4-6-7-12(11(5-2)10-13)15-9-8-14-3/h6-7H,4-5,8-10H2,1-3H3/b7-6-,12-11+ |
| InChIKey | WLUCOMRCSKOOOM-BIXBEFAMSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene?
The IUPAC name of (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene (CID 145498388) is (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene.
What is the SMILES notation for (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene?
The canonical SMILES for (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene is CC/C=C\C(OCCOC)=C(\CC)CF.
What is the InChIKey of (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene?
The InChIKey is WLUCOMRCSKOOOM-BIXBEFAMSA-N. The full InChI is InChI=1S/C12H21FO2/c1-4-6-7-12(11(5-2)10-13)15-9-8-14-3/h6-7H,4-5,8-10H2,1-3H3/b7-6-,12-11+.
What are the key properties of (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene?
(3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene has a molecular weight of 216.30 g/mol, XLogP of 3.25, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-(fluoromethyl)-4-(2-methoxyethoxy)octa-3,5-diene is sourced from PubChem (CID 145498388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).