C37H56N2O3S — CID 145498501
methanethiol;1-[2-(2-naphthalen-1-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,5,5,6,6,7,7-octamethyl-2-methylideneoctyl)pyrrolidine-2,5-dione (PubChem CID 145498501) has the molecular formula C37H56N2O3S and a molecular weight of 608.93 g/mol. Its IUPAC name is methanethiol;1-[2-(2-naphthalen-1-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,5,5,6,6,7,7-octamethyl-2-methylideneoctyl)pyrrolidine-2,5-dione.
| Compound Name | methanethiol;1-[2-(2-naphthalen-1-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,5,5,6,6,7,7-octamethyl-2-methylideneoctyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145498501 |
| Molecular Formula | C37H56N2O3S |
| Molecular Weight | 608.93 g/mol |
| Exact Mass | 608.40 |
| IUPAC Name | methanethiol;1-[2-(2-naphthalen-1-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,5,5,6,6,7,7-octamethyl-2-methylideneoctyl)pyrrolidine-2,5-dione |
| SMILES | C=C(CC1CC(=O)N(CCN2CCOC2c2cccc3ccccc23)C1=O)CC(C)(C)C(C)(C)C(C)(C)C(C)(C)C.CS |
| InChI | InChI=1S/C36H52N2O3.CH4S/c1-25(24-34(5,6)36(9,10)35(7,8)33(2,3)4)22-27-23-30(39)38(31(27)40)19-18-37-20-21-41-32(37)29-17-13-15-26-14-11-12-16-28(26)29;1-2/h11-17,27,32H,1,18-24H2,2-10H3;2H,1H3 |
| InChIKey | ZSPKBPSADDKJRQ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.93 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|