C37H58FN3O3 — CID 145499081
N-[2-[3-[2-[2-[(1-cyclohexyl-2-methylprop-2-enyl)amino]ethoxy]-3-ethylphenyl]propylamino]-2-oxoethyl]propanamide;ethane;1-fluoro-4-methylbenzene (PubChem CID 145499081) has the molecular formula C37H58FN3O3 and a molecular weight of 611.89 g/mol. Its IUPAC name is N-[2-[3-[2-[2-[(1-cyclohexyl-2-methylprop-2-enyl)amino]ethoxy]-3-ethylphenyl]propylamino]-2-oxoethyl]propanamide;ethane;1-fluoro-4-methylbenzene.
| Compound Name | N-[2-[3-[2-[2-[(1-cyclohexyl-2-methylprop-2-enyl)amino]ethoxy]-3-ethylphenyl]propylamino]-2-oxoethyl]propanamide;ethane;1-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 145499081 |
| Molecular Formula | C37H58FN3O3 |
| Molecular Weight | 611.89 g/mol |
| Exact Mass | 611.45 |
| IUPAC Name | N-[2-[3-[2-[2-[(1-cyclohexyl-2-methylprop-2-enyl)amino]ethoxy]-3-ethylphenyl]propylamino]-2-oxoethyl]propanamide;ethane;1-fluoro-4-methylbenzene |
| SMILES | C=C(C)C(NCCOc1c(CC)cccc1CCCNC(=O)CNC(=O)CC)C1CCCCC1.CC.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H45N3O3.C7H7F.C2H6/c1-5-22-14-10-15-24(16-11-17-29-26(33)20-31-25(32)6-2)28(22)34-19-18-30-27(21(3)4)23-12-8-7-9-13-23;1-6-2-4-7(8)5-3-6;1-2/h10,14-15,23,27,30H,3,5-9,11-13,16-20H2,1-2,4H3,(H,29,33)(H,31,32);2-5H,1H3;1-2H3 |
| InChIKey | NCCLTLZURLMTRU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.89 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|