C24H24BrN5O5S — CID 145499769
4-[4-[[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]piperidin-1-yl]sulfonylbenzene-1,2-diol (PubChem CID 145499769) has the molecular formula C24H24BrN5O5S and a molecular weight of 574.46 g/mol. Its IUPAC name is 4-[4-[[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]piperidin-1-yl]sulfonylbenzene-1,2-diol.
| Compound Name | 4-[4-[[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]piperidin-1-yl]sulfonylbenzene-1,2-diol |
|---|---|
| PubChem CID | 145499769 |
| Molecular Formula | C24H24BrN5O5S |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | 4-[4-[[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]piperidin-1-yl]sulfonylbenzene-1,2-diol |
| SMILES | O=S(=O)(c1ccc(O)c(O)c1)N1CCC(CNc2cc(-c3ccccc3O)nc3c(Br)cnn23)CC1 |
| InChI | InChI=1S/C24H24BrN5O5S/c25-18-14-27-30-23(12-19(28-24(18)30)17-3-1-2-4-20(17)31)26-13-15-7-9-29(10-8-15)36(34,35)16-5-6-21(32)22(33)11-16/h1-6,11-12,14-15,26,31-33H,7-10,13H2 |
| InChIKey | WNNBLCNJEVCJKW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|