C18H38O — CID 14550228
(2S,6R,10R)-6,10,14-trimethylpentadecan-2-ol (PubChem CID 14550228) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is (2S,6R,10R)-6,10,14-trimethylpentadecan-2-ol.
| Compound Name | (2S,6R,10R)-6,10,14-trimethylpentadecan-2-ol |
|---|---|
| PubChem CID | 14550228 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | (2S,6R,10R)-6,10,14-trimethylpentadecan-2-ol |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@H](C)O |
| InChI | InChI=1S/C18H38O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h15-19H,6-14H2,1-5H3/t16-,17-,18+/m1/s1 |
| InChIKey | HTUZNQGPJMIELO-KURKYZTESA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |