C23H31N5O — CID 14552100
11-[6-(4-methylpiperazin-1-yl)hexyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 14552100) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 11-[6-(4-methylpiperazin-1-yl)hexyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[6-(4-methylpiperazin-1-yl)hexyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 14552100 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 11-[6-(4-methylpiperazin-1-yl)hexyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CN1CCN(CCCCCCN2c3ccccc3C(=O)Nc3cccnc32)CC1 |
| InChI | InChI=1S/C23H31N5O/c1-26-15-17-27(18-16-26)13-6-2-3-7-14-28-21-11-5-4-9-19(21)23(29)25-20-10-8-12-24-22(20)28/h4-5,8-12H,2-3,6-7,13-18H2,1H3,(H,25,29) |
| InChIKey | GGJVVFVSLOQLGV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|