About 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one
6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one (PubChem CID 14552120) has the molecular formula C20H24Cl2O3
and a molecular weight of 383.32 g/mol. Its IUPAC name is 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one.
Molecular Properties
| Compound Name | 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one |
| PubChem CID | 14552120 |
| Molecular Formula | C20H24Cl2O3 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one |
| SMILES | O=C1CC(O)CC(/C=C/c2c(Cl)cc(Cl)cc2C2CCCCCC2)O1 |
| InChI | InChI=1S/C20H24Cl2O3/c21-14-9-18(13-5-3-1-2-4-6-13)17(19(22)10-14)8-7-16-11-15(23)12-20(24)25-16/h7-10,13,15-16,23H,1-6,11-12H2/b8-7+ |
| InChIKey | FZCLYEGRPGOWEU-BQYQJAHWSA-N |
| XLogP | 5.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one?
The IUPAC name of 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one (CID 14552120) is 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one.
What is the SMILES notation for 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one?
The canonical SMILES for 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one is O=C1CC(O)CC(/C=C/c2c(Cl)cc(Cl)cc2C2CCCCCC2)O1.
What is the InChIKey of 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one?
The InChIKey is FZCLYEGRPGOWEU-BQYQJAHWSA-N. The full InChI is InChI=1S/C20H24Cl2O3/c21-14-9-18(13-5-3-1-2-4-6-13)17(19(22)10-14)8-7-16-11-15(23)12-20(24)25-16/h7-10,13,15-16,23H,1-6,11-12H2/b8-7+.
What are the key properties of 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one?
6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one has a molecular weight of 383.32 g/mol, XLogP of 5.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-(2,4-dichloro-6-cycloheptylphenyl)ethenyl]-4-hydroxyoxan-2-one is sourced from PubChem (CID 14552120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).