C14H26N2O2 — CID 14552454
1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-amine (PubChem CID 14552454) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-amine.
| Compound Name | 1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-amine |
|---|---|
| PubChem CID | 14552454 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-amine |
| SMILES | CCCN1CCC(N)C2CC3(CCC21)OCCO3 |
| InChI | InChI=1S/C14H26N2O2/c1-2-6-16-7-4-12(15)11-10-14(5-3-13(11)16)17-8-9-18-14/h11-13H,2-10,15H2,1H3 |
| InChIKey | OXBOSLCANAXQGE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |