C16H31N3O4S — CID 14552455
4'-(dimethylsulfamoylamino)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline] (PubChem CID 14552455) has the molecular formula C16H31N3O4S and a molecular weight of 361.51 g/mol. Its IUPAC name is 4'-(dimethylsulfamoylamino)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline].
| Compound Name | 4'-(dimethylsulfamoylamino)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline] |
|---|---|
| PubChem CID | 14552455 |
| Molecular Formula | C16H31N3O4S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4'-(dimethylsulfamoylamino)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline] |
| SMILES | CCCN1CCC(NS(=O)(=O)N(C)C)C2CC3(CCC21)OCCO3 |
| InChI | InChI=1S/C16H31N3O4S/c1-4-8-19-9-6-14(17-24(20,21)18(2)3)13-12-16(7-5-15(13)19)22-10-11-23-16/h13-15,17H,4-12H2,1-3H3 |
| InChIKey | OCKDKOFWYQPANI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |