C14H22N4O — CID 14552480
2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-9-ol (PubChem CID 14552480) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-9-ol.
| Compound Name | 2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-9-ol |
|---|---|
| PubChem CID | 14552480 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-9-ol |
| SMILES | CCCN1CCC(O)C2Cc3nc(N)ncc3CC21 |
| InChI | InChI=1S/C14H22N4O/c1-2-4-18-5-3-13(19)10-7-11-9(6-12(10)18)8-16-14(15)17-11/h8,10,12-13,19H,2-7H2,1H3,(H2,15,16,17) |
| InChIKey | RJCQCDVGTJTOQD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |