C16H26N4S — CID 14552487
8-(methylsulfanylmethyl)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine (PubChem CID 14552487) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 8-(methylsulfanylmethyl)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine.
| Compound Name | 8-(methylsulfanylmethyl)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine |
|---|---|
| PubChem CID | 14552487 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 8-(methylsulfanylmethyl)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine |
| SMILES | CCCN1CC(CSC)CC2Cc3nc(N)ncc3CC21 |
| InChI | InChI=1S/C16H26N4S/c1-3-4-20-9-11(10-21-2)5-12-6-14-13(7-15(12)20)8-18-16(17)19-14/h8,11-12,15H,3-7,9-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | WGFUSWJMJMDIAZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |