C12H10N2 — CID 14553
7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene (PubChem CID 14553) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene.
| Compound Name | 7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene |
|---|---|
| PubChem CID | 14553 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene |
| SMILES | C1=CC2=C3C=CC=CN3C=CN2C=C1 |
| InChI | InChI=1S/C12H10N2/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1/h1-10H |
| InChIKey | MSDXGKHMUSAIHM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |