About 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride
2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride (PubChem CID 14553354) has the molecular formula C25H32ClNO3
and a molecular weight of 429.99 g/mol. Its IUPAC name is 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride |
| PubChem CID | 14553354 |
| Molecular Formula | C25H32ClNO3 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCC1CCN(Cc3ccccc3)CC1)C2.Cl |
| InChI | InChI=1S/C25H31NO3.ClH/c1-28-23-15-21-14-20(25(27)22(21)16-24(23)29-2)9-8-18-10-12-26(13-11-18)17-19-6-4-3-5-7-19;/h3-7,15-16,18,20H,8-14,17H2,1-2H3;1H |
| InChIKey | WGOKOSMDAWSPBT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride?
The IUPAC name of 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride (CID 14553354) is 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride.
What is the SMILES notation for 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride?
The canonical SMILES for 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride is COc1cc2c(cc1OC)C(=O)C(CCC1CCN(Cc3ccccc3)CC1)C2.Cl.
What is the InChIKey of 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride?
The InChIKey is WGOKOSMDAWSPBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31NO3.ClH/c1-28-23-15-21-14-20(25(27)22(21)16-24(23)29-2)9-8-18-10-12-26(13-11-18)17-19-6-4-3-5-7-19;/h3-7,15-16,18,20H,8-14,17H2,1-2H3;1H.
What are the key properties of 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride?
2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride has a molecular weight of 429.99 g/mol, XLogP of 5.17, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-benzylpiperidin-4-yl)ethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride is sourced from PubChem (CID 14553354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).