About 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone
2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone (PubChem CID 14554) has the molecular formula C8H3Cl5O
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone.
Molecular Properties
| Compound Name | 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone |
| PubChem CID | 14554 |
| Molecular Formula | C8H3Cl5O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 289.86 |
| IUPAC Name | 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone |
| SMILES | O=C(c1cc(Cl)c(Cl)cc1Cl)C(Cl)Cl |
| InChI | InChI=1S/C8H3Cl5O/c9-4-2-6(11)5(10)1-3(4)7(14)8(12)13/h1-2,8H |
| InChIKey | WKJXVVFAALGBOH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone?
The IUPAC name of 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone (CID 14554) is 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone.
What is the SMILES notation for 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone?
The canonical SMILES for 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone is O=C(c1cc(Cl)c(Cl)cc1Cl)C(Cl)Cl.
What is the InChIKey of 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone?
The InChIKey is WKJXVVFAALGBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl5O/c9-4-2-6(11)5(10)1-3(4)7(14)8(12)13/h1-2,8H.
What are the key properties of 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone?
2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone has a molecular weight of 292.38 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-1-(2,4,5-trichlorophenyl)ethanone is sourced from PubChem (CID 14554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).