C16H19F5N4O — CID 14554113
1-[[1-[2-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one (PubChem CID 14554113) has the molecular formula C16H19F5N4O and a molecular weight of 378.35 g/mol. Its IUPAC name is 1-[[1-[2-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[1-[2-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 14554113 |
| Molecular Formula | C16H19F5N4O |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[[1-[2-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CC1CCN(c2ccnc(C(F)(F)C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H19F5N4O/c17-15(18,16(19,20)21)14-22-6-3-12(23-14)24-8-4-11(5-9-24)10-25-7-1-2-13(25)26/h3,6,11H,1-2,4-5,7-10H2 |
| InChIKey | LKMFBUMXOCAGRW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|