C15H16O5 — CID 14554359
methyl 2-(4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-ylmethoxy)acetate (PubChem CID 14554359) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 2-(4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-ylmethoxy)acetate.
| Compound Name | methyl 2-(4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-ylmethoxy)acetate |
|---|---|
| PubChem CID | 14554359 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl 2-(4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-ylmethoxy)acetate |
| SMILES | COC(=O)COCc1cccc2c1OC1CC3OC3C21 |
| InChI | InChI=1S/C15H16O5/c1-17-12(16)7-18-6-8-3-2-4-9-13-10(19-14(8)9)5-11-15(13)20-11/h2-4,10-11,13,15H,5-7H2,1H3 |
| InChIKey | MSBYQQCOQKZWFE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|