About 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine (PubChem CID 14555425) has the molecular formula C7H9ClN4S
and a molecular weight of 216.70 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine |
| PubChem CID | 14555425 |
| Molecular Formula | C7H9ClN4S |
| Molecular Weight | 216.70 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine |
| SMILES | NC1=NCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H9ClN4S/c8-6-11-3-5(13-6)4-12-2-1-10-7(12)9/h3H,1-2,4H2,(H2,9,10) |
| InChIKey | HEGJXUAZAMFDKB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.70 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine (CID 14555425) is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine is NC1=NCCN1Cc1cnc(Cl)s1.
What is the InChIKey of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine?
The InChIKey is HEGJXUAZAMFDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN4S/c8-6-11-3-5(13-6)4-12-2-1-10-7(12)9/h3H,1-2,4H2,(H2,9,10).
What are the key properties of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine?
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine has a molecular weight of 216.70 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 14555425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).