About 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride (PubChem CID 14555426) has the molecular formula C7H10Cl2N4S
and a molecular weight of 253.16 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride |
| PubChem CID | 14555426 |
| Molecular Formula | C7H10Cl2N4S |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride |
| SMILES | Cl.NC1=NCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H9ClN4S.ClH/c8-6-11-3-5(13-6)4-12-2-1-10-7(12)9;/h3H,1-2,4H2,(H2,9,10);1H |
| InChIKey | FPASBNNTJFKSDC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride?
The IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride (CID 14555426) is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride.
What is the SMILES notation for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride?
The canonical SMILES for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride is Cl.NC1=NCCN1Cc1cnc(Cl)s1.
What is the InChIKey of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride?
The InChIKey is FPASBNNTJFKSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN4S.ClH/c8-6-11-3-5(13-6)4-12-2-1-10-7(12)9;/h3H,1-2,4H2,(H2,9,10);1H.
What are the key properties of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride?
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride has a molecular weight of 253.16 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-amine;hydrochloride is sourced from PubChem (CID 14555426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).